C46H61Br2NO2S5 — CID 118625918
1,3-bis(5-bromo-6-hexylthieno[3,2-b]thiophen-2-yl)-5-(2-hexyldecyl)thieno[3,4-c]pyrrole-4,6-dione (PubChem CID 118625918) has the molecular formula C46H61Br2NO2S5 and a molecular weight of 980.14 g/mol. Its IUPAC name is 1,3-bis(5-bromo-6-hexylthieno[3,2-b]thiophen-2-yl)-5-(2-hexyldecyl)thieno[3,4-c]pyrrole-4,6-dione.
| Compound Name | 1,3-bis(5-bromo-6-hexylthieno[3,2-b]thiophen-2-yl)-5-(2-hexyldecyl)thieno[3,4-c]pyrrole-4,6-dione |
|---|---|
| PubChem CID | 118625918 |
| Molecular Formula | C46H61Br2NO2S5 |
| Molecular Weight | 980.14 g/mol |
| Exact Mass | 977.17 |
| IUPAC Name | 1,3-bis(5-bromo-6-hexylthieno[3,2-b]thiophen-2-yl)-5-(2-hexyldecyl)thieno[3,4-c]pyrrole-4,6-dione |
| SMILES | CCCCCCCCC(CCCCCC)CN1C(=O)c2c(-c3cc4sc(Br)c(CCCCCC)c4s3)sc(-c3cc4sc(Br)c(CCCCCC)c4s3)c2C1=O |
| InChI | InChI=1S/C46H61Br2NO2S5/c1-5-9-13-17-18-20-24-30(23-19-14-10-6-2)29-49-45(50)37-38(46(49)51)42(36-28-34-40(53-36)32(44(48)55-34)26-22-16-12-8-4)56-41(37)35-27-33-39(52-35)31(43(47)54-33)25-21-15-11-7-3/h27-28,30H,5-26,29H2,1-4H3 |
| InChIKey | ZHVNURHQBFITSI-UHFFFAOYSA-N |
| XLogP | 18.34 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 980.14 |
| LogP ≤ 5 | 18.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|