C48H63Br2NO2S4 — CID 142749692
4,7-bis(5-bromo-6-octylthieno[3,2-b]thiophen-2-yl)-2-(2-butyloctyl)isoindole-1,3-dione (PubChem CID 142749692) has the molecular formula C48H63Br2NO2S4 and a molecular weight of 974.11 g/mol. Its IUPAC name is 4,7-bis(5-bromo-6-octylthieno[3,2-b]thiophen-2-yl)-2-(2-butyloctyl)isoindole-1,3-dione.
| Compound Name | 4,7-bis(5-bromo-6-octylthieno[3,2-b]thiophen-2-yl)-2-(2-butyloctyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 142749692 |
| Molecular Formula | C48H63Br2NO2S4 |
| Molecular Weight | 974.11 g/mol |
| Exact Mass | 971.21 |
| IUPAC Name | 4,7-bis(5-bromo-6-octylthieno[3,2-b]thiophen-2-yl)-2-(2-butyloctyl)isoindole-1,3-dione |
| SMILES | CCCCCCCCc1c(Br)sc2cc(-c3ccc(-c4cc5sc(Br)c(CCCCCCCC)c5s4)c4c3C(=O)N(CC(CCCC)CCCCCC)C4=O)sc12 |
| InChI | InChI=1S/C48H63Br2NO2S4/c1-5-9-13-16-18-21-25-35-43-39(56-45(35)49)29-37(54-43)33-27-28-34(38-30-40-44(55-38)36(46(50)57-40)26-22-19-17-14-10-6-2)42-41(33)47(52)51(48(42)53)31-32(23-12-8-4)24-20-15-11-7-3/h27-30,32H,5-26,31H2,1-4H3 |
| InChIKey | LYETZUVREKTBJM-UHFFFAOYSA-N |
| XLogP | 18.28 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 974.11 |
| LogP ≤ 5 | 18.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|