C32H50S — CID 118629184
tris(1-adamantyl)-ethyl-λ4-sulfane (PubChem CID 118629184) has the molecular formula C32H50S and a molecular weight of 466.82 g/mol. Its IUPAC name is tris(1-adamantyl)-ethyl-λ4-sulfane.
| Compound Name | tris(1-adamantyl)-ethyl-λ4-sulfane |
|---|---|
| PubChem CID | 118629184 |
| Molecular Formula | C32H50S |
| Molecular Weight | 466.82 g/mol |
| Exact Mass | 466.36 |
| IUPAC Name | tris(1-adamantyl)-ethyl-λ4-sulfane |
| SMILES | CCS(C12CC3CC(CC(C3)C1)C2)(C12CC3CC(CC(C3)C1)C2)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C32H50S/c1-2-33(30-12-21-3-22(13-30)5-23(4-21)14-30,31-15-24-6-25(16-31)8-26(7-24)17-31)32-18-27-9-28(19-32)11-29(10-27)20-32/h21-29H,2-20H2,1H3 |
| InChIKey | ZDZPEUCBKOWDBK-UHFFFAOYSA-N |
| XLogP | 8.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.82 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |