About tris(1-adamantyl)-ethyl-λ4-sulfane
tris(1-adamantyl)-ethyl-λ4-sulfane (PubChem CID 118629184) has the molecular formula C32H50S
and a molecular weight of 466.82 g/mol. Its IUPAC name is tris(1-adamantyl)-ethyl-λ4-sulfane.
Molecular Properties
| Compound Name | tris(1-adamantyl)-ethyl-λ4-sulfane |
| PubChem CID | 118629184 |
| Molecular Formula | C32H50S |
| Molecular Weight | 466.82 g/mol |
| Exact Mass | 466.36 |
| IUPAC Name | tris(1-adamantyl)-ethyl-λ4-sulfane |
| SMILES | CCS(C12CC3CC(CC(C3)C1)C2)(C12CC3CC(CC(C3)C1)C2)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C32H50S/c1-2-33(30-12-21-3-22(13-30)5-23(4-21)14-30,31-15-24-6-25(16-31)8-26(7-24)17-31)32-18-27-9-28(19-32)11-29(10-27)20-32/h21-29H,2-20H2,1H3 |
| InChIKey | ZDZPEUCBKOWDBK-UHFFFAOYSA-N |
| XLogP | 8.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 466.82 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze tris(1-adamantyl)-ethyl-λ4-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tris(1-adamantyl)-ethyl-λ4-sulfane?
The IUPAC name of tris(1-adamantyl)-ethyl-λ4-sulfane (CID 118629184) is tris(1-adamantyl)-ethyl-λ4-sulfane.
What is the SMILES notation for tris(1-adamantyl)-ethyl-λ4-sulfane?
The canonical SMILES for tris(1-adamantyl)-ethyl-λ4-sulfane is CCS(C12CC3CC(CC(C3)C1)C2)(C12CC3CC(CC(C3)C1)C2)C12CC3CC(CC(C3)C1)C2.
What is the InChIKey of tris(1-adamantyl)-ethyl-λ4-sulfane?
The InChIKey is ZDZPEUCBKOWDBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H50S/c1-2-33(30-12-21-3-22(13-30)5-23(4-21)14-30,31-15-24-6-25(16-31)8-26(7-24)17-31)32-18-27-9-28(19-32)11-29(10-27)20-32/h21-29H,2-20H2,1H3.
What are the key properties of tris(1-adamantyl)-ethyl-λ4-sulfane?
tris(1-adamantyl)-ethyl-λ4-sulfane has a molecular weight of 466.82 g/mol, XLogP of 8.72, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tris(1-adamantyl)-ethyl-λ4-sulfane is sourced from PubChem (CID 118629184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).