C29H24FN8O4S- — CID 118630892
CID 118630892 (PubChem CID 118630892) has the molecular formula C29H24FN8O4S- and a molecular weight of 599.63 g/mol.
| Compound Name | CID 118630892 |
|---|---|
| PubChem CID | 118630892 |
| Molecular Formula | C29H24FN8O4S- |
| Molecular Weight | 599.63 g/mol |
| Exact Mass | 599.16 |
| IUPAC Name | — |
| SMILES | COc1ncc(-c2nn([C@H](C)c3cc4ccc(F)cn4c(=O)c3-c3ccccc3)c3ncnc(N)c23)cc1/N=[S-](=O)/OC |
| InChI | InChI=1S/C29H24FN8O4S/c1-16(21-12-20-10-9-19(30)14-37(20)29(39)23(21)17-7-5-4-6-8-17)38-27-24(26(31)33-15-34-27)25(35-38)18-11-22(36-43(40)42-3)28(41-2)32-13-18/h4-16H,1-3H3,(H2,31,33,34)/q-1/t16-/m1/s1 |
| InChIKey | KALGNADCEGLETD-MRXNPFEDSA-N |
| XLogP | 4.85 |
| TPSA | 151.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.63 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|