C23H19FN6O — CID 140786700
2-[(1R)-1-[(6-amino-5-isocyanopyrimidin-4-yl)amino]propyl]-7-fluoro-3-phenylquinolizin-4-one (PubChem CID 140786700) has the molecular formula C23H19FN6O and a molecular weight of 414.44 g/mol. Its IUPAC name is 2-[(1R)-1-[(6-amino-5-isocyanopyrimidin-4-yl)amino]propyl]-7-fluoro-3-phenylquinolizin-4-one.
| Compound Name | 2-[(1R)-1-[(6-amino-5-isocyanopyrimidin-4-yl)amino]propyl]-7-fluoro-3-phenylquinolizin-4-one |
|---|---|
| PubChem CID | 140786700 |
| Molecular Formula | C23H19FN6O |
| Molecular Weight | 414.44 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | 2-[(1R)-1-[(6-amino-5-isocyanopyrimidin-4-yl)amino]propyl]-7-fluoro-3-phenylquinolizin-4-one |
| SMILES | [C-]#[N+]c1c(N)ncnc1N[C@H](CC)c1cc2ccc(F)cn2c(=O)c1-c1ccccc1 |
| InChI | InChI=1S/C23H19FN6O/c1-3-18(29-22-20(26-2)21(25)27-13-28-22)17-11-16-10-9-15(24)12-30(16)23(31)19(17)14-7-5-4-6-8-14/h4-13,18H,3H2,1H3,(H3,25,27,28,29)/t18-/m1/s1 |
| InChIKey | BCRNDNGDLXQOSF-GOSISDBHSA-N |
| XLogP | 4.59 |
| TPSA | 89.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.44 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|