C21H23FN2O2S — CID 140786719
(S)-4-(7-fluoro-4-oxo-3-phenylquinolizin-2-yl)-2-methylpentane-2-sulfinamide (PubChem CID 140786719) has the molecular formula C21H23FN2O2S and a molecular weight of 386.49 g/mol. Its IUPAC name is (S)-4-(7-fluoro-4-oxo-3-phenylquinolizin-2-yl)-2-methylpentane-2-sulfinamide.
| Compound Name | (S)-4-(7-fluoro-4-oxo-3-phenylquinolizin-2-yl)-2-methylpentane-2-sulfinamide |
|---|---|
| PubChem CID | 140786719 |
| Molecular Formula | C21H23FN2O2S |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | (S)-4-(7-fluoro-4-oxo-3-phenylquinolizin-2-yl)-2-methylpentane-2-sulfinamide |
| SMILES | CC(CC(C)(C)[S@@](N)=O)c1cc2ccc(F)cn2c(=O)c1-c1ccccc1 |
| InChI | InChI=1S/C21H23FN2O2S/c1-14(12-21(2,3)27(23)26)18-11-17-10-9-16(22)13-24(17)20(25)19(18)15-7-5-4-6-8-15/h4-11,13-14H,12,23H2,1-3H3/t14?,27-/m0/s1 |
| InChIKey | JXQSCAICNRJRMV-SYESMYBYSA-N |
| XLogP | 4.00 |
| TPSA | 64.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |