C23H18F2N2O — CID 129262395
2-[(1S)-1-aminoethyl]-7-fluoro-1-(4-fluorophenyl)-3-phenylquinolizin-4-one (PubChem CID 129262395) has the molecular formula C23H18F2N2O and a molecular weight of 376.41 g/mol. Its IUPAC name is 2-[(1S)-1-aminoethyl]-7-fluoro-1-(4-fluorophenyl)-3-phenylquinolizin-4-one.
| Compound Name | 2-[(1S)-1-aminoethyl]-7-fluoro-1-(4-fluorophenyl)-3-phenylquinolizin-4-one |
|---|---|
| PubChem CID | 129262395 |
| Molecular Formula | C23H18F2N2O |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | 2-[(1S)-1-aminoethyl]-7-fluoro-1-(4-fluorophenyl)-3-phenylquinolizin-4-one |
| SMILES | C[C@H](N)c1c(-c2ccccc2)c(=O)n2cc(F)ccc2c1-c1ccc(F)cc1 |
| InChI | InChI=1S/C23H18F2N2O/c1-14(26)20-21(16-7-9-17(24)10-8-16)19-12-11-18(25)13-27(19)23(28)22(20)15-5-3-2-4-6-15/h2-14H,26H2,1H3/t14-/m0/s1 |
| InChIKey | ZSQXGTZIOXPSKD-AWEZNQCLSA-N |
| XLogP | 4.93 |
| TPSA | 47.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |