C22H15F3N6O — CID 140786722
2-[(1S)-1-[(6-amino-5-isocyanopyrimidin-4-yl)amino]ethyl]-3-(3,5-difluorophenyl)-7-fluoroquinolizin-4-one (PubChem CID 140786722) has the molecular formula C22H15F3N6O and a molecular weight of 436.40 g/mol. Its IUPAC name is 2-[(1S)-1-[(6-amino-5-isocyanopyrimidin-4-yl)amino]ethyl]-3-(3,5-difluorophenyl)-7-fluoroquinolizin-4-one.
| Compound Name | 2-[(1S)-1-[(6-amino-5-isocyanopyrimidin-4-yl)amino]ethyl]-3-(3,5-difluorophenyl)-7-fluoroquinolizin-4-one |
|---|---|
| PubChem CID | 140786722 |
| Molecular Formula | C22H15F3N6O |
| Molecular Weight | 436.40 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | 2-[(1S)-1-[(6-amino-5-isocyanopyrimidin-4-yl)amino]ethyl]-3-(3,5-difluorophenyl)-7-fluoroquinolizin-4-one |
| SMILES | [C-]#[N+]c1c(N)ncnc1N[C@@H](C)c1cc2ccc(F)cn2c(=O)c1-c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C22H15F3N6O/c1-11(30-21-19(27-2)20(26)28-10-29-21)17-8-16-4-3-13(23)9-31(16)22(32)18(17)12-5-14(24)7-15(25)6-12/h3-11H,1H3,(H3,26,28,29,30)/t11-/m0/s1 |
| InChIKey | URKNFRXYBWSAIS-NSHDSACASA-N |
| XLogP | 4.48 |
| TPSA | 89.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.40 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|