C19H23N3O — CID 118631136
7-methyl-2-(4-methylphenyl)-8-pentylimidazo[1,2-a]pyrimidin-5-one (PubChem CID 118631136) has the molecular formula C19H23N3O and a molecular weight of 309.41 g/mol. Its IUPAC name is 7-methyl-2-(4-methylphenyl)-8-pentylimidazo[1,2-a]pyrimidin-5-one.
| Compound Name | 7-methyl-2-(4-methylphenyl)-8-pentylimidazo[1,2-a]pyrimidin-5-one |
|---|---|
| PubChem CID | 118631136 |
| Molecular Formula | C19H23N3O |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.18 |
| IUPAC Name | 7-methyl-2-(4-methylphenyl)-8-pentylimidazo[1,2-a]pyrimidin-5-one |
| SMILES | CCCCCn1c(C)cc(=O)n2cc(-c3ccc(C)cc3)nc12 |
| InChI | InChI=1S/C19H23N3O/c1-4-5-6-11-21-15(3)12-18(23)22-13-17(20-19(21)22)16-9-7-14(2)8-10-16/h7-10,12-13H,4-6,11H2,1-3H3 |
| InChIKey | DIWBKBMXPOXBJC-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 39.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|