C20H16ClN3O — CID 118631145
8-benzyl-2-(4-chlorophenyl)-7-methylimidazo[1,2-a]pyrimidin-5-one (PubChem CID 118631145) has the molecular formula C20H16ClN3O and a molecular weight of 349.82 g/mol. Its IUPAC name is 8-benzyl-2-(4-chlorophenyl)-7-methylimidazo[1,2-a]pyrimidin-5-one.
| Compound Name | 8-benzyl-2-(4-chlorophenyl)-7-methylimidazo[1,2-a]pyrimidin-5-one |
|---|---|
| PubChem CID | 118631145 |
| Molecular Formula | C20H16ClN3O |
| Molecular Weight | 349.82 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | 8-benzyl-2-(4-chlorophenyl)-7-methylimidazo[1,2-a]pyrimidin-5-one |
| SMILES | Cc1cc(=O)n2cc(-c3ccc(Cl)cc3)nc2n1Cc1ccccc1 |
| InChI | InChI=1S/C20H16ClN3O/c1-14-11-19(25)24-13-18(16-7-9-17(21)10-8-16)22-20(24)23(14)12-15-5-3-2-4-6-15/h2-11,13H,12H2,1H3 |
| InChIKey | ZVTAGZNKWZEYEJ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 39.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.82 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |