C23H24Cl2N2O5 — CID 118632030
2-[(2S,5R,6S)-6-(3-chlorophenyl)-5-(4-chlorophenyl)-4-[(1R)-1-formamidobutyl]-3-oxomorpholin-2-yl]acetic acid (PubChem CID 118632030) has the molecular formula C23H24Cl2N2O5 and a molecular weight of 479.36 g/mol. Its IUPAC name is 2-[(2S,5R,6S)-6-(3-chlorophenyl)-5-(4-chlorophenyl)-4-[(1R)-1-formamidobutyl]-3-oxomorpholin-2-yl]acetic acid.
| Compound Name | 2-[(2S,5R,6S)-6-(3-chlorophenyl)-5-(4-chlorophenyl)-4-[(1R)-1-formamidobutyl]-3-oxomorpholin-2-yl]acetic acid |
|---|---|
| PubChem CID | 118632030 |
| Molecular Formula | C23H24Cl2N2O5 |
| Molecular Weight | 479.36 g/mol |
| Exact Mass | 478.11 |
| IUPAC Name | 2-[(2S,5R,6S)-6-(3-chlorophenyl)-5-(4-chlorophenyl)-4-[(1R)-1-formamidobutyl]-3-oxomorpholin-2-yl]acetic acid |
| SMILES | CCC[C@H](NC=O)N1C(=O)[C@H](CC(=O)O)O[C@@H](c2cccc(Cl)c2)[C@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H24Cl2N2O5/c1-2-4-19(26-13-28)27-21(14-7-9-16(24)10-8-14)22(15-5-3-6-17(25)11-15)32-18(23(27)31)12-20(29)30/h3,5-11,13,18-19,21-22H,2,4,12H2,1H3,(H,26,28)(H,29,30)/t18-,19+,21+,22-/m0/s1 |
| InChIKey | LUBKNHLPNOOQPS-PSBKLILYSA-N |
| XLogP | 4.35 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.36 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|