C24H26Cl2N2O3 — CID 118632032
N-[(1S)-1-[(3S,6R)-2-(3-chlorophenyl)-3-(4-chlorophenyl)-5-oxo-6-prop-2-enylmorpholin-4-yl]butyl]formamide (PubChem CID 118632032) has the molecular formula C24H26Cl2N2O3 and a molecular weight of 461.39 g/mol. Its IUPAC name is N-[(1S)-1-[(3S,6R)-2-(3-chlorophenyl)-3-(4-chlorophenyl)-5-oxo-6-prop-2-enylmorpholin-4-yl]butyl]formamide.
| Compound Name | N-[(1S)-1-[(3S,6R)-2-(3-chlorophenyl)-3-(4-chlorophenyl)-5-oxo-6-prop-2-enylmorpholin-4-yl]butyl]formamide |
|---|---|
| PubChem CID | 118632032 |
| Molecular Formula | C24H26Cl2N2O3 |
| Molecular Weight | 461.39 g/mol |
| Exact Mass | 460.13 |
| IUPAC Name | N-[(1S)-1-[(3S,6R)-2-(3-chlorophenyl)-3-(4-chlorophenyl)-5-oxo-6-prop-2-enylmorpholin-4-yl]butyl]formamide |
| SMILES | C=CC[C@H]1OC(c2cccc(Cl)c2)[C@H](c2ccc(Cl)cc2)N([C@@H](CCC)NC=O)C1=O |
| InChI | InChI=1S/C24H26Cl2N2O3/c1-3-6-20-24(30)28(21(7-4-2)27-15-29)22(16-10-12-18(25)13-11-16)23(31-20)17-8-5-9-19(26)14-17/h3,5,8-15,20-23H,1,4,6-7H2,2H3,(H,27,29)/t20-,21+,22+,23?/m1/s1 |
| InChIKey | KFDVMKFEVHGANE-ZFSMBLLKSA-N |
| XLogP | 5.45 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.39 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|