C25H27Cl2NO2 — CID 118632043
(2R,5S,6R)-6-(3-chlorophenyl)-5-(4-chlorophenyl)-4-[(1R)-1-cyclopropylpropyl]-2-prop-2-enylmorpholin-3-one (PubChem CID 118632043) has the molecular formula C25H27Cl2NO2 and a molecular weight of 444.40 g/mol. Its IUPAC name is (2R,5S,6R)-6-(3-chlorophenyl)-5-(4-chlorophenyl)-4-[(1R)-1-cyclopropylpropyl]-2-prop-2-enylmorpholin-3-one.
| Compound Name | (2R,5S,6R)-6-(3-chlorophenyl)-5-(4-chlorophenyl)-4-[(1R)-1-cyclopropylpropyl]-2-prop-2-enylmorpholin-3-one |
|---|---|
| PubChem CID | 118632043 |
| Molecular Formula | C25H27Cl2NO2 |
| Molecular Weight | 444.40 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | (2R,5S,6R)-6-(3-chlorophenyl)-5-(4-chlorophenyl)-4-[(1R)-1-cyclopropylpropyl]-2-prop-2-enylmorpholin-3-one |
| SMILES | C=CC[C@H]1O[C@H](c2cccc(Cl)c2)[C@H](c2ccc(Cl)cc2)N([C@H](CC)C2CC2)C1=O |
| InChI | InChI=1S/C25H27Cl2NO2/c1-3-6-22-25(29)28(21(4-2)16-9-10-16)23(17-11-13-19(26)14-12-17)24(30-22)18-7-5-8-20(27)15-18/h3,5,7-8,11-16,21-24H,1,4,6,9-10H2,2H3/t21-,22-,23+,24-/m1/s1 |
| InChIKey | PUQBMLGLNVGGAP-JLLPCOHGSA-N |
| XLogP | 6.77 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.40 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|