C23H23Cl2NO3 — CID 89490994
(2S)-2-[(2R,3R,6S)-2-(3-chlorophenyl)-3-(4-chlorophenyl)-5-oxo-6-prop-2-enylmorpholin-4-yl]butanal (PubChem CID 89490994) has the molecular formula C23H23Cl2NO3 and a molecular weight of 432.35 g/mol. Its IUPAC name is (2S)-2-[(2R,3R,6S)-2-(3-chlorophenyl)-3-(4-chlorophenyl)-5-oxo-6-prop-2-enylmorpholin-4-yl]butanal.
| Compound Name | (2S)-2-[(2R,3R,6S)-2-(3-chlorophenyl)-3-(4-chlorophenyl)-5-oxo-6-prop-2-enylmorpholin-4-yl]butanal |
|---|---|
| PubChem CID | 89490994 |
| Molecular Formula | C23H23Cl2NO3 |
| Molecular Weight | 432.35 g/mol |
| Exact Mass | 431.11 |
| IUPAC Name | (2S)-2-[(2R,3R,6S)-2-(3-chlorophenyl)-3-(4-chlorophenyl)-5-oxo-6-prop-2-enylmorpholin-4-yl]butanal |
| SMILES | C=CC[C@@H]1O[C@H](c2cccc(Cl)c2)[C@@H](c2ccc(Cl)cc2)N([C@H](C=O)CC)C1=O |
| InChI | InChI=1S/C23H23Cl2NO3/c1-3-6-20-23(28)26(19(4-2)14-27)21(15-9-11-17(24)12-10-15)22(29-20)16-7-5-8-18(25)13-16/h3,5,7-14,19-22H,1,4,6H2,2H3/t19-,20-,21+,22+/m0/s1 |
| InChIKey | NXPDWKFVJYSRDJ-FNAHDJPLSA-N |
| XLogP | 5.56 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.35 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|