C24H26Cl2N2O3 — CID 90357944
(2S)-2-[(2S,3R,6S)-2-(3-chlorophenyl)-3-(4-chlorophenyl)-5-oxo-6-prop-2-enylmorpholin-4-yl]pentanamide (PubChem CID 90357944) has the molecular formula C24H26Cl2N2O3 and a molecular weight of 461.39 g/mol. Its IUPAC name is (2S)-2-[(2S,3R,6S)-2-(3-chlorophenyl)-3-(4-chlorophenyl)-5-oxo-6-prop-2-enylmorpholin-4-yl]pentanamide.
| Compound Name | (2S)-2-[(2S,3R,6S)-2-(3-chlorophenyl)-3-(4-chlorophenyl)-5-oxo-6-prop-2-enylmorpholin-4-yl]pentanamide |
|---|---|
| PubChem CID | 90357944 |
| Molecular Formula | C24H26Cl2N2O3 |
| Molecular Weight | 461.39 g/mol |
| Exact Mass | 460.13 |
| IUPAC Name | (2S)-2-[(2S,3R,6S)-2-(3-chlorophenyl)-3-(4-chlorophenyl)-5-oxo-6-prop-2-enylmorpholin-4-yl]pentanamide |
| SMILES | C=CC[C@@H]1O[C@@H](c2cccc(Cl)c2)[C@@H](c2ccc(Cl)cc2)N(C(CCC)C(N)=O)C1=O |
| InChI | InChI=1S/C24H26Cl2N2O3/c1-3-6-19(23(27)29)28-21(15-10-12-17(25)13-11-15)22(16-8-5-9-18(26)14-16)31-20(7-4-2)24(28)30/h4-5,8-14,19-22H,2-3,6-7H2,1H3,(H2,27,29)/t19?,20-,21+,22-/m0/s1 |
| InChIKey | HKXGAJPXRILQBO-KBRMVUAJSA-N |
| XLogP | 5.23 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.39 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|