C26H29Cl2N3O4 — CID 118622844
(2R)-N'-acetyl-2-[(2S,3R,6S)-2-(3-chlorophenyl)-3-(4-chlorophenyl)-5-oxo-6-prop-2-enylmorpholin-4-yl]pentanehydrazide (PubChem CID 118622844) has the molecular formula C26H29Cl2N3O4 and a molecular weight of 518.44 g/mol. Its IUPAC name is (2R)-N'-acetyl-2-[(2S,3R,6S)-2-(3-chlorophenyl)-3-(4-chlorophenyl)-5-oxo-6-prop-2-enylmorpholin-4-yl]pentanehydrazide.
| Compound Name | (2R)-N'-acetyl-2-[(2S,3R,6S)-2-(3-chlorophenyl)-3-(4-chlorophenyl)-5-oxo-6-prop-2-enylmorpholin-4-yl]pentanehydrazide |
|---|---|
| PubChem CID | 118622844 |
| Molecular Formula | C26H29Cl2N3O4 |
| Molecular Weight | 518.44 g/mol |
| Exact Mass | 517.15 |
| IUPAC Name | (2R)-N'-acetyl-2-[(2S,3R,6S)-2-(3-chlorophenyl)-3-(4-chlorophenyl)-5-oxo-6-prop-2-enylmorpholin-4-yl]pentanehydrazide |
| SMILES | C=CC[C@@H]1O[C@@H](c2cccc(Cl)c2)[C@@H](c2ccc(Cl)cc2)N(C(CCC)C(=O)NNC(C)=O)C1=O |
| InChI | InChI=1S/C26H29Cl2N3O4/c1-4-7-21(25(33)30-29-16(3)32)31-23(17-11-13-19(27)14-12-17)24(18-9-6-10-20(28)15-18)35-22(8-5-2)26(31)34/h5-6,9-15,21-24H,2,4,7-8H2,1,3H3,(H,29,32)(H,30,33)/t21?,22-,23+,24-/m0/s1 |
| InChIKey | LODXARSBJMIULP-NHYNNZIHSA-N |
| XLogP | 4.92 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.44 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|