C24H24Cl2N2O2 — CID 90358057
(2S)-2-[(2R,3S,6R)-2-(3-chlorophenyl)-3-(4-chlorophenyl)-5-oxo-6-prop-2-enylmorpholin-4-yl]pentanenitrile (PubChem CID 90358057) has the molecular formula C24H24Cl2N2O2 and a molecular weight of 443.37 g/mol. Its IUPAC name is (2S)-2-[(2R,3S,6R)-2-(3-chlorophenyl)-3-(4-chlorophenyl)-5-oxo-6-prop-2-enylmorpholin-4-yl]pentanenitrile.
| Compound Name | (2S)-2-[(2R,3S,6R)-2-(3-chlorophenyl)-3-(4-chlorophenyl)-5-oxo-6-prop-2-enylmorpholin-4-yl]pentanenitrile |
|---|---|
| PubChem CID | 90358057 |
| Molecular Formula | C24H24Cl2N2O2 |
| Molecular Weight | 443.37 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | (2S)-2-[(2R,3S,6R)-2-(3-chlorophenyl)-3-(4-chlorophenyl)-5-oxo-6-prop-2-enylmorpholin-4-yl]pentanenitrile |
| SMILES | C=CC[C@H]1O[C@H](c2cccc(Cl)c2)[C@H](c2ccc(Cl)cc2)N([C@H](C#N)CCC)C1=O |
| InChI | InChI=1S/C24H24Cl2N2O2/c1-3-6-20(15-27)28-22(16-10-12-18(25)13-11-16)23(17-8-5-9-19(26)14-17)30-21(7-4-2)24(28)29/h4-5,8-14,20-23H,2-3,6-7H2,1H3/t20-,21+,22-,23+/m0/s1 |
| InChIKey | DYEBJOPAJIEIKG-GSPCLOLRSA-N |
| XLogP | 6.27 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.37 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|