C20H27ClFN3O5 — CID 118636416
tert-butyl 3-[[(E)-3-(2-chloro-3-fluoro-4-pyridinyl)prop-2-enoyl]amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (PubChem CID 118636416) has the molecular formula C20H27ClFN3O5 and a molecular weight of 443.90 g/mol. Its IUPAC name is tert-butyl 3-[[(E)-3-(2-chloro-3-fluoro-4-pyridinyl)prop-2-enoyl]amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.
| Compound Name | tert-butyl 3-[[(E)-3-(2-chloro-3-fluoro-4-pyridinyl)prop-2-enoyl]amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
|---|---|
| PubChem CID | 118636416 |
| Molecular Formula | C20H27ClFN3O5 |
| Molecular Weight | 443.90 g/mol |
| Exact Mass | 443.16 |
| IUPAC Name | tert-butyl 3-[[(E)-3-(2-chloro-3-fluoro-4-pyridinyl)prop-2-enoyl]amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| SMILES | CC(C)(C)OC(=O)NC(CNC(=O)/C=C/c1ccnc(Cl)c1F)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H27ClFN3O5/c1-19(2,3)29-17(27)13(25-18(28)30-20(4,5)6)11-24-14(26)8-7-12-9-10-23-16(21)15(12)22/h7-10,13H,11H2,1-6H3,(H,24,26)(H,25,28)/b8-7+ |
| InChIKey | SQEDWBFGZZGPDB-BQYQJAHWSA-N |
| XLogP | 3.24 |
| TPSA | 106.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.90 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|