C13H16ClFN2O2 — CID 169468572
tert-butyl N-[3-(2-chloro-3-fluoro-4-pyridinyl)prop-2-enyl]carbamate (PubChem CID 169468572) has the molecular formula C13H16ClFN2O2 and a molecular weight of 286.73 g/mol. Its IUPAC name is tert-butyl N-[3-(2-chloro-3-fluoro-4-pyridinyl)prop-2-enyl]carbamate.
| Compound Name | tert-butyl N-[3-(2-chloro-3-fluoro-4-pyridinyl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 169468572 |
| Molecular Formula | C13H16ClFN2O2 |
| Molecular Weight | 286.73 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | tert-butyl N-[3-(2-chloro-3-fluoro-4-pyridinyl)prop-2-enyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC=Cc1ccnc(Cl)c1F |
| InChI | InChI=1S/C13H16ClFN2O2/c1-13(2,3)19-12(18)17-7-4-5-9-6-8-16-11(14)10(9)15/h4-6,8H,7H2,1-3H3,(H,17,18) |
| InChIKey | NTWOKCIZVMEHGF-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.73 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|