C26H33IO3 — CID 118638063
methyl (2S,3R)-3-cyclopropyl-3-[4-iodo-3-[1-(2,4,5-trimethylphenyl)propoxy]phenyl]-2-methylpropanoate (PubChem CID 118638063) has the molecular formula C26H33IO3 and a molecular weight of 520.45 g/mol. Its IUPAC name is methyl (2S,3R)-3-cyclopropyl-3-[4-iodo-3-[1-(2,4,5-trimethylphenyl)propoxy]phenyl]-2-methylpropanoate.
| Compound Name | methyl (2S,3R)-3-cyclopropyl-3-[4-iodo-3-[1-(2,4,5-trimethylphenyl)propoxy]phenyl]-2-methylpropanoate |
|---|---|
| PubChem CID | 118638063 |
| Molecular Formula | C26H33IO3 |
| Molecular Weight | 520.45 g/mol |
| Exact Mass | 520.15 |
| IUPAC Name | methyl (2S,3R)-3-cyclopropyl-3-[4-iodo-3-[1-(2,4,5-trimethylphenyl)propoxy]phenyl]-2-methylpropanoate |
| SMILES | CCC(Oc1cc([C@H](C2CC2)[C@H](C)C(=O)OC)ccc1I)c1cc(C)c(C)cc1C |
| InChI | InChI=1S/C26H33IO3/c1-7-23(21-13-16(3)15(2)12-17(21)4)30-24-14-20(10-11-22(24)27)25(19-8-9-19)18(5)26(28)29-6/h10-14,18-19,23,25H,7-9H2,1-6H3/t18-,23?,25-/m0/s1 |
| InChIKey | VEQSZMPKKJDAKM-WBPUULEKSA-N |
| XLogP | 7.05 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.45 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|