C22H27N7O5S2 — CID 118639093
[(1R,2S,4R)-4-[[5-[4-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylmethyl)thiophene-2-carbonyl]pyrimidin-4-yl]amino]-2-hydroxycyclopentyl]methyl sulfamate (PubChem CID 118639093) has the molecular formula C22H27N7O5S2 and a molecular weight of 533.64 g/mol. Its IUPAC name is [(1R,2S,4R)-4-[[5-[4-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylmethyl)thiophene-2-carbonyl]pyrimidin-4-yl]amino]-2-hydroxycyclopentyl]methyl sulfamate.
| Compound Name | [(1R,2S,4R)-4-[[5-[4-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylmethyl)thiophene-2-carbonyl]pyrimidin-4-yl]amino]-2-hydroxycyclopentyl]methyl sulfamate |
|---|---|
| PubChem CID | 118639093 |
| Molecular Formula | C22H27N7O5S2 |
| Molecular Weight | 533.64 g/mol |
| Exact Mass | 533.15 |
| IUPAC Name | [(1R,2S,4R)-4-[[5-[4-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylmethyl)thiophene-2-carbonyl]pyrimidin-4-yl]amino]-2-hydroxycyclopentyl]methyl sulfamate |
| SMILES | NS(=O)(=O)OC[C@H]1C[C@@H](Nc2ncncc2C(=O)c2cc(CN3CCn4ccnc4C3)cs2)C[C@@H]1O |
| InChI | InChI=1S/C22H27N7O5S2/c23-36(32,33)34-11-15-6-16(7-18(15)30)27-22-17(8-24-13-26-22)21(31)19-5-14(12-35-19)9-28-3-4-29-2-1-25-20(29)10-28/h1-2,5,8,12-13,15-16,18,30H,3-4,6-7,9-11H2,(H2,23,32,33)(H,24,26,27)/t15-,16-,18+/m1/s1 |
| InChIKey | GIRKQEDWIURLCI-NUJGCVRESA-N |
| XLogP | 0.75 |
| TPSA | 165.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.64 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |