C25H28ClN5O5S2 — CID 118628838
[(1R,2S,4R)-4-[[5-[4-[(1S)-7-chloro-2-methyl-3,4-dihydro-1H-isoquinolin-1-yl]thiophene-2-carbonyl]pyrimidin-4-yl]amino]-2-hydroxycyclopentyl]methyl sulfamate (PubChem CID 118628838) has the molecular formula C25H28ClN5O5S2 and a molecular weight of 578.12 g/mol. Its IUPAC name is [(1R,2S,4R)-4-[[5-[4-[(1S)-7-chloro-2-methyl-3,4-dihydro-1H-isoquinolin-1-yl]thiophene-2-carbonyl]pyrimidin-4-yl]amino]-2-hydroxycyclopentyl]methyl sulfamate.
| Compound Name | [(1R,2S,4R)-4-[[5-[4-[(1S)-7-chloro-2-methyl-3,4-dihydro-1H-isoquinolin-1-yl]thiophene-2-carbonyl]pyrimidin-4-yl]amino]-2-hydroxycyclopentyl]methyl sulfamate |
|---|---|
| PubChem CID | 118628838 |
| Molecular Formula | C25H28ClN5O5S2 |
| Molecular Weight | 578.12 g/mol |
| Exact Mass | 577.12 |
| IUPAC Name | [(1R,2S,4R)-4-[[5-[4-[(1S)-7-chloro-2-methyl-3,4-dihydro-1H-isoquinolin-1-yl]thiophene-2-carbonyl]pyrimidin-4-yl]amino]-2-hydroxycyclopentyl]methyl sulfamate |
| SMILES | CN1CCc2ccc(Cl)cc2[C@H]1c1csc(C(=O)c2cncnc2N[C@@H]2C[C@H](COS(N)(=O)=O)[C@@H](O)C2)c1 |
| InChI | InChI=1S/C25H28ClN5O5S2/c1-31-5-4-14-2-3-17(26)8-19(14)23(31)16-7-22(37-12-16)24(33)20-10-28-13-29-25(20)30-18-6-15(21(32)9-18)11-36-38(27,34)35/h2-3,7-8,10,12-13,15,18,21,23,32H,4-6,9,11H2,1H3,(H2,27,34,35)(H,28,29,30)/t15-,18-,21+,23-/m1/s1 |
| InChIKey | WMYZRWPUITZCPU-LJTXAQECSA-N |
| XLogP | 2.77 |
| TPSA | 147.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.12 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |