C25H27ClN4O6S2 — CID 118628923
[(1R,2S,4R)-4-[[5-[5-[(1R)-8-chloro-1,3,4,5-tetrahydro-2-benzoxepin-1-yl]thiophene-2-carbonyl]pyrimidin-4-yl]amino]-2-hydroxycyclopentyl]methyl sulfamate (PubChem CID 118628923) has the molecular formula C25H27ClN4O6S2 and a molecular weight of 579.10 g/mol. Its IUPAC name is [(1R,2S,4R)-4-[[5-[5-[(1R)-8-chloro-1,3,4,5-tetrahydro-2-benzoxepin-1-yl]thiophene-2-carbonyl]pyrimidin-4-yl]amino]-2-hydroxycyclopentyl]methyl sulfamate.
| Compound Name | [(1R,2S,4R)-4-[[5-[5-[(1R)-8-chloro-1,3,4,5-tetrahydro-2-benzoxepin-1-yl]thiophene-2-carbonyl]pyrimidin-4-yl]amino]-2-hydroxycyclopentyl]methyl sulfamate |
|---|---|
| PubChem CID | 118628923 |
| Molecular Formula | C25H27ClN4O6S2 |
| Molecular Weight | 579.10 g/mol |
| Exact Mass | 578.11 |
| IUPAC Name | [(1R,2S,4R)-4-[[5-[5-[(1R)-8-chloro-1,3,4,5-tetrahydro-2-benzoxepin-1-yl]thiophene-2-carbonyl]pyrimidin-4-yl]amino]-2-hydroxycyclopentyl]methyl sulfamate |
| SMILES | NS(=O)(=O)OC[C@H]1C[C@@H](Nc2ncncc2C(=O)c2ccc([C@@H]3OCCCc4ccc(Cl)cc43)s2)C[C@@H]1O |
| InChI | InChI=1S/C25H27ClN4O6S2/c26-16-4-3-14-2-1-7-35-24(18(14)9-16)22-6-5-21(37-22)23(32)19-11-28-13-29-25(19)30-17-8-15(20(31)10-17)12-36-38(27,33)34/h3-6,9,11,13,15,17,20,24,31H,1-2,7-8,10,12H2,(H2,27,33,34)(H,28,29,30)/t15-,17-,20+,24-/m1/s1 |
| InChIKey | YUCOPUMTOYJCEH-MXUPFSIYSA-N |
| XLogP | 3.25 |
| TPSA | 153.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.10 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |