C25H25ClF2N4O6S2 — CID 118647918
[(1R,2S,4R)-4-[[5-[4-[(1S)-7-chloro-4,4-difluoro-1,3-dihydroisochromen-1-yl]-5-methylthiophene-2-carbonyl]pyrimidin-4-yl]amino]-2-hydroxycyclopentyl]methyl sulfamate (PubChem CID 118647918) has the molecular formula C25H25ClF2N4O6S2 and a molecular weight of 615.08 g/mol. Its IUPAC name is [(1R,2S,4R)-4-[[5-[4-[(1S)-7-chloro-4,4-difluoro-1,3-dihydroisochromen-1-yl]-5-methylthiophene-2-carbonyl]pyrimidin-4-yl]amino]-2-hydroxycyclopentyl]methyl sulfamate.
| Compound Name | [(1R,2S,4R)-4-[[5-[4-[(1S)-7-chloro-4,4-difluoro-1,3-dihydroisochromen-1-yl]-5-methylthiophene-2-carbonyl]pyrimidin-4-yl]amino]-2-hydroxycyclopentyl]methyl sulfamate |
|---|---|
| PubChem CID | 118647918 |
| Molecular Formula | C25H25ClF2N4O6S2 |
| Molecular Weight | 615.08 g/mol |
| Exact Mass | 614.09 |
| IUPAC Name | [(1R,2S,4R)-4-[[5-[4-[(1S)-7-chloro-4,4-difluoro-1,3-dihydroisochromen-1-yl]-5-methylthiophene-2-carbonyl]pyrimidin-4-yl]amino]-2-hydroxycyclopentyl]methyl sulfamate |
| SMILES | Cc1sc(C(=O)c2cncnc2N[C@@H]2C[C@H](COS(N)(=O)=O)[C@@H](O)C2)cc1[C@H]1OCC(F)(F)c2ccc(Cl)cc21 |
| InChI | InChI=1S/C25H25ClF2N4O6S2/c1-12-16(23-17-5-14(26)2-3-19(17)25(27,28)10-37-23)7-21(39-12)22(34)18-8-30-11-31-24(18)32-15-4-13(20(33)6-15)9-38-40(29,35)36/h2-3,5,7-8,11,13,15,20,23,33H,4,6,9-10H2,1H3,(H2,29,35,36)(H,30,31,32)/t13-,15-,20+,23-/m1/s1 |
| InChIKey | FBEUALYMBOBMCX-WUJNXBBQSA-N |
| XLogP | 3.71 |
| TPSA | 153.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.08 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |