C23H24ClN5O6S2 — CID 118654065
[(1R,2S,4R)-4-[[5-[5-chloro-4-(6,8-dihydro-5H-pyrano[3,4-b]pyridin-8-yl)thiophene-2-carbonyl]pyrimidin-4-yl]amino]-2-hydroxycyclopentyl]methyl sulfamate (PubChem CID 118654065) has the molecular formula C23H24ClN5O6S2 and a molecular weight of 566.06 g/mol. Its IUPAC name is [(1R,2S,4R)-4-[[5-[5-chloro-4-(6,8-dihydro-5H-pyrano[3,4-b]pyridin-8-yl)thiophene-2-carbonyl]pyrimidin-4-yl]amino]-2-hydroxycyclopentyl]methyl sulfamate.
| Compound Name | [(1R,2S,4R)-4-[[5-[5-chloro-4-(6,8-dihydro-5H-pyrano[3,4-b]pyridin-8-yl)thiophene-2-carbonyl]pyrimidin-4-yl]amino]-2-hydroxycyclopentyl]methyl sulfamate |
|---|---|
| PubChem CID | 118654065 |
| Molecular Formula | C23H24ClN5O6S2 |
| Molecular Weight | 566.06 g/mol |
| Exact Mass | 565.09 |
| IUPAC Name | [(1R,2S,4R)-4-[[5-[5-chloro-4-(6,8-dihydro-5H-pyrano[3,4-b]pyridin-8-yl)thiophene-2-carbonyl]pyrimidin-4-yl]amino]-2-hydroxycyclopentyl]methyl sulfamate |
| SMILES | NS(=O)(=O)OC[C@H]1C[C@@H](Nc2ncncc2C(=O)c2cc(C3OCCc4cccnc43)c(Cl)s2)C[C@@H]1O |
| InChI | InChI=1S/C23H24ClN5O6S2/c24-22-15(21-19-12(3-5-34-21)2-1-4-27-19)8-18(36-22)20(31)16-9-26-11-28-23(16)29-14-6-13(17(30)7-14)10-35-37(25,32)33/h1-2,4,8-9,11,13-14,17,21,30H,3,5-7,10H2,(H2,25,32,33)(H,26,28,29)/t13-,14-,17+,21?/m1/s1 |
| InChIKey | GNIPKZOEEZNRIO-GFICLGNZSA-N |
| XLogP | 2.25 |
| TPSA | 166.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.06 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |