C26H27F3N4O6S2 — CID 118647734
[(1R,2S,4R)-2-hydroxy-4-[[5-[5-methyl-4-[(1S)-7-(trifluoromethyl)-3,4-dihydro-1H-isochromen-1-yl]thiophene-2-carbonyl]pyrimidin-4-yl]amino]cyclopentyl]methyl sulfamate (PubChem CID 118647734) has the molecular formula C26H27F3N4O6S2 and a molecular weight of 612.65 g/mol. Its IUPAC name is [(1R,2S,4R)-2-hydroxy-4-[[5-[5-methyl-4-[(1S)-7-(trifluoromethyl)-3,4-dihydro-1H-isochromen-1-yl]thiophene-2-carbonyl]pyrimidin-4-yl]amino]cyclopentyl]methyl sulfamate.
| Compound Name | [(1R,2S,4R)-2-hydroxy-4-[[5-[5-methyl-4-[(1S)-7-(trifluoromethyl)-3,4-dihydro-1H-isochromen-1-yl]thiophene-2-carbonyl]pyrimidin-4-yl]amino]cyclopentyl]methyl sulfamate |
|---|---|
| PubChem CID | 118647734 |
| Molecular Formula | C26H27F3N4O6S2 |
| Molecular Weight | 612.65 g/mol |
| Exact Mass | 612.13 |
| IUPAC Name | [(1R,2S,4R)-2-hydroxy-4-[[5-[5-methyl-4-[(1S)-7-(trifluoromethyl)-3,4-dihydro-1H-isochromen-1-yl]thiophene-2-carbonyl]pyrimidin-4-yl]amino]cyclopentyl]methyl sulfamate |
| SMILES | Cc1sc(C(=O)c2cncnc2N[C@@H]2C[C@H](COS(N)(=O)=O)[C@@H](O)C2)cc1[C@H]1OCCc2ccc(C(F)(F)F)cc21 |
| InChI | InChI=1S/C26H27F3N4O6S2/c1-13-18(24-19-7-16(26(27,28)29)3-2-14(19)4-5-38-24)9-22(40-13)23(35)20-10-31-12-32-25(20)33-17-6-15(21(34)8-17)11-39-41(30,36)37/h2-3,7,9-10,12,15,17,21,24,34H,4-6,8,11H2,1H3,(H2,30,36,37)(H,31,32,33)/t15-,17-,21+,24-/m1/s1 |
| InChIKey | WICJRPUFBVHAJN-PJXWOBROSA-N |
| XLogP | 3.53 |
| TPSA | 153.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.65 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |