C24H25ClN4O5S3 — CID 118639360
[(1R,2S,4R)-4-[[5-[4-(6-chloro-1,3-dihydro-2-benzothiophen-1-yl)-5-methylthiophene-2-carbonyl]pyrimidin-4-yl]amino]-2-hydroxycyclopentyl]methyl sulfamate (PubChem CID 118639360) has the molecular formula C24H25ClN4O5S3 and a molecular weight of 581.14 g/mol. Its IUPAC name is [(1R,2S,4R)-4-[[5-[4-(6-chloro-1,3-dihydro-2-benzothiophen-1-yl)-5-methylthiophene-2-carbonyl]pyrimidin-4-yl]amino]-2-hydroxycyclopentyl]methyl sulfamate.
| Compound Name | [(1R,2S,4R)-4-[[5-[4-(6-chloro-1,3-dihydro-2-benzothiophen-1-yl)-5-methylthiophene-2-carbonyl]pyrimidin-4-yl]amino]-2-hydroxycyclopentyl]methyl sulfamate |
|---|---|
| PubChem CID | 118639360 |
| Molecular Formula | C24H25ClN4O5S3 |
| Molecular Weight | 581.14 g/mol |
| Exact Mass | 580.07 |
| IUPAC Name | [(1R,2S,4R)-4-[[5-[4-(6-chloro-1,3-dihydro-2-benzothiophen-1-yl)-5-methylthiophene-2-carbonyl]pyrimidin-4-yl]amino]-2-hydroxycyclopentyl]methyl sulfamate |
| SMILES | Cc1sc(C(=O)c2cncnc2N[C@@H]2C[C@H](COS(N)(=O)=O)[C@@H](O)C2)cc1C1SCc2ccc(Cl)cc21 |
| InChI | InChI=1S/C24H25ClN4O5S3/c1-12-17(23-18-5-15(25)3-2-13(18)10-35-23)7-21(36-12)22(31)19-8-27-11-28-24(19)29-16-4-14(20(30)6-16)9-34-37(26,32)33/h2-3,5,7-8,11,14,16,20,23,30H,4,6,9-10H2,1H3,(H2,26,32,33)(H,27,28,29)/t14-,16-,20+,23?/m1/s1 |
| InChIKey | JRYLAISXLLQDNG-JLCTYWFPSA-N |
| XLogP | 3.84 |
| TPSA | 144.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.14 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |