C22H24BrN5O4S — CID 118639259
[4-[[(1R,3R,4S)-3-(aminooxymethyl)-4-hydroxycyclopentyl]amino]pyrimidin-5-yl]-[4-[1-(6-bromo-2-pyridinyl)-1-hydroxyethyl]thiophen-2-yl]methanone (PubChem CID 118639259) has the molecular formula C22H24BrN5O4S and a molecular weight of 534.44 g/mol. Its IUPAC name is [4-[[(1R,3R,4S)-3-(aminooxymethyl)-4-hydroxycyclopentyl]amino]pyrimidin-5-yl]-[4-[1-(6-bromo-2-pyridinyl)-1-hydroxyethyl]thiophen-2-yl]methanone.
| Compound Name | [4-[[(1R,3R,4S)-3-(aminooxymethyl)-4-hydroxycyclopentyl]amino]pyrimidin-5-yl]-[4-[1-(6-bromo-2-pyridinyl)-1-hydroxyethyl]thiophen-2-yl]methanone |
|---|---|
| PubChem CID | 118639259 |
| Molecular Formula | C22H24BrN5O4S |
| Molecular Weight | 534.44 g/mol |
| Exact Mass | 533.07 |
| IUPAC Name | [4-[[(1R,3R,4S)-3-(aminooxymethyl)-4-hydroxycyclopentyl]amino]pyrimidin-5-yl]-[4-[1-(6-bromo-2-pyridinyl)-1-hydroxyethyl]thiophen-2-yl]methanone |
| SMILES | CC(O)(c1csc(C(=O)c2cncnc2N[C@@H]2C[C@H](CON)[C@@H](O)C2)c1)c1cccc(Br)n1 |
| InChI | InChI=1S/C22H24BrN5O4S/c1-22(31,18-3-2-4-19(23)28-18)13-6-17(33-10-13)20(30)15-8-25-11-26-21(15)27-14-5-12(9-32-24)16(29)7-14/h2-4,6,8,10-12,14,16,29,31H,5,7,9,24H2,1H3,(H,25,26,27)/t12-,14-,16+,22?/m1/s1 |
| InChIKey | JJWGZZXHEKJEGQ-UKTDZUQWSA-N |
| XLogP | 2.62 |
| TPSA | 143.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.44 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|