C29H38ClN6O2P — CID 118639856
Iruplinalkib (PubChem CID 118639856) has the molecular formula C29H38ClN6O2P and a molecular weight of 569.10 g/mol. Its IUPAC name is 5-chloro-4-N-(2-dimethylphosphorylphenyl)-2-N-[2-methoxy-4-(9-methyl-3,9-diazaspiro[5.5]undecan-3-yl)phenyl]pyrimidine-2,4-diamine.
| Compound Name | Iruplinalkib |
|---|---|
| PubChem CID | 118639856 |
| Molecular Formula | C29H38ClN6O2P |
| Molecular Weight | 569.10 g/mol |
| Exact Mass | 568.25 |
| IUPAC Name | 5-chloro-4-N-(2-dimethylphosphorylphenyl)-2-N-[2-methoxy-4-(9-methyl-3,9-diazaspiro[5.5]undecan-3-yl)phenyl]pyrimidine-2,4-diamine |
| SMILES | CN1CCC2(CC1)CCN(CC2)C3=CC(=C(C=C3)NC4=NC=C(C(=N4)NC5=CC=CC=C5P(=O)(C)C)Cl)OC |
| InChI | InChI=1S/C29H38ClN6O2P/c1-35-15-11-29(12-16-35)13-17-36(18-14-29)21-9-10-23(25(19-21)38-2)33-28-31-20-22(30)27(34-28)32-24-7-5-6-8-26(24)39(3,4)37/h5-10,19-20H,11-18H2,1-4H3,(H2,31,32,33,34) |
| InChIKey | ZPCCNHQDFZCULN-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 82.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | 829 |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.10 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|