C25H32ClN6O3P — CID 44515722
2-[4-[4-[[5-chloro-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]-3-methoxyphenyl]piperazin-1-yl]ethanol (PubChem CID 44515722) has the molecular formula C25H32ClN6O3P and a molecular weight of 531.00 g/mol. Its IUPAC name is 2-[4-[4-[[5-chloro-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]-3-methoxyphenyl]piperazin-1-yl]ethanol.
| Compound Name | 2-[4-[4-[[5-chloro-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]-3-methoxyphenyl]piperazin-1-yl]ethanol |
|---|---|
| PubChem CID | 44515722 |
| Molecular Formula | C25H32ClN6O3P |
| Molecular Weight | 531.00 g/mol |
| Exact Mass | 530.20 |
| IUPAC Name | 2-[4-[4-[[5-chloro-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]-3-methoxyphenyl]piperazin-1-yl]ethanol |
| SMILES | COc1cc(N2CCN(CCO)CC2)ccc1Nc1ncc(Cl)c(Nc2ccccc2P(C)(C)=O)n1 |
| InChI | InChI=1S/C25H32ClN6O3P/c1-35-22-16-18(32-12-10-31(11-13-32)14-15-33)8-9-20(22)29-25-27-17-19(26)24(30-25)28-21-6-4-5-7-23(21)36(2,3)34/h4-9,16-17,33H,10-15H2,1-3H3,(H2,27,28,29,30) |
| InChIKey | CBCRRZVVZMJUTF-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 102.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.00 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|