C22H27N3O5 — CID 118642557
methyl 2-[2-acetyl-5-[4-(ethenoxymethyl)-4-methylpiperidin-1-yl]-7-methylimidazo[1,2-a]pyridin-6-yl]-2-oxoacetate (PubChem CID 118642557) has the molecular formula C22H27N3O5 and a molecular weight of 413.47 g/mol. Its IUPAC name is methyl 2-[2-acetyl-5-[4-(ethenoxymethyl)-4-methylpiperidin-1-yl]-7-methylimidazo[1,2-a]pyridin-6-yl]-2-oxoacetate.
| Compound Name | methyl 2-[2-acetyl-5-[4-(ethenoxymethyl)-4-methylpiperidin-1-yl]-7-methylimidazo[1,2-a]pyridin-6-yl]-2-oxoacetate |
|---|---|
| PubChem CID | 118642557 |
| Molecular Formula | C22H27N3O5 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | methyl 2-[2-acetyl-5-[4-(ethenoxymethyl)-4-methylpiperidin-1-yl]-7-methylimidazo[1,2-a]pyridin-6-yl]-2-oxoacetate |
| SMILES | C=COCC1(C)CCN(c2c(C(=O)C(=O)OC)c(C)cc3nc(C(C)=O)cn23)CC1 |
| InChI | InChI=1S/C22H27N3O5/c1-6-30-13-22(4)7-9-24(10-8-22)20-18(19(27)21(28)29-5)14(2)11-17-23-16(15(3)26)12-25(17)20/h6,11-12H,1,7-10,13H2,2-5H3 |
| InChIKey | JZDKLLHBMIORGR-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 90.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|