C23H33N3O5 — CID 126627453
methyl (2S)-2-[4-(4-but-3-enyl-4-methylpiperidin-1-yl)-2-[hydroxy(methoxy)methyl]-6-methylpyrazolo[1,5-a]pyridin-5-yl]-2-hydroxyacetate (PubChem CID 126627453) has the molecular formula C23H33N3O5 and a molecular weight of 431.53 g/mol. Its IUPAC name is methyl (2S)-2-[4-(4-but-3-enyl-4-methylpiperidin-1-yl)-2-[hydroxy(methoxy)methyl]-6-methylpyrazolo[1,5-a]pyridin-5-yl]-2-hydroxyacetate.
| Compound Name | methyl (2S)-2-[4-(4-but-3-enyl-4-methylpiperidin-1-yl)-2-[hydroxy(methoxy)methyl]-6-methylpyrazolo[1,5-a]pyridin-5-yl]-2-hydroxyacetate |
|---|---|
| PubChem CID | 126627453 |
| Molecular Formula | C23H33N3O5 |
| Molecular Weight | 431.53 g/mol |
| Exact Mass | 431.24 |
| IUPAC Name | methyl (2S)-2-[4-(4-but-3-enyl-4-methylpiperidin-1-yl)-2-[hydroxy(methoxy)methyl]-6-methylpyrazolo[1,5-a]pyridin-5-yl]-2-hydroxyacetate |
| SMILES | C=CCCC1(C)CCN(c2c([C@H](O)C(=O)OC)c(C)cn3nc(C(O)OC)cc23)CC1 |
| InChI | InChI=1S/C23H33N3O5/c1-6-7-8-23(3)9-11-25(12-10-23)19-17-13-16(21(28)30-4)24-26(17)14-15(2)18(19)20(27)22(29)31-5/h6,13-14,20-21,27-28H,1,7-12H2,2-5H3/t20-,21?/m0/s1 |
| InChIKey | HXISNLUVEWUCCA-BGERDNNASA-N |
| XLogP | 3.06 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.53 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|