C23H25Cl2N7O3S — CID 118643607
[(1S,2S,3R,4R)-3-[[6-chloro-2-(4-chloro-2-morpholin-4-yl-1,3-thiazol-5-yl)-1H-imidazo[4,5-b]pyridin-7-yl]amino]-2-bicyclo[2.2.1]hept-5-enyl] N,N-dimethylcarbamate (PubChem CID 118643607) has the molecular formula C23H25Cl2N7O3S and a molecular weight of 550.47 g/mol. Its IUPAC name is [(1S,2S,3R,4R)-3-[[6-chloro-2-(4-chloro-2-morpholin-4-yl-1,3-thiazol-5-yl)-1H-imidazo[4,5-b]pyridin-7-yl]amino]-2-bicyclo[2.2.1]hept-5-enyl] N,N-dimethylcarbamate.
| Compound Name | [(1S,2S,3R,4R)-3-[[6-chloro-2-(4-chloro-2-morpholin-4-yl-1,3-thiazol-5-yl)-1H-imidazo[4,5-b]pyridin-7-yl]amino]-2-bicyclo[2.2.1]hept-5-enyl] N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 118643607 |
| Molecular Formula | C23H25Cl2N7O3S |
| Molecular Weight | 550.47 g/mol |
| Exact Mass | 549.11 |
| IUPAC Name | [(1S,2S,3R,4R)-3-[[6-chloro-2-(4-chloro-2-morpholin-4-yl-1,3-thiazol-5-yl)-1H-imidazo[4,5-b]pyridin-7-yl]amino]-2-bicyclo[2.2.1]hept-5-enyl] N,N-dimethylcarbamate |
| SMILES | CN(C)C(=O)O[C@@H]1[C@H](Nc2c(Cl)cnc3nc(-c4sc(N5CCOCC5)nc4Cl)[nH]c23)[C@H]2C=C[C@@H]1C2 |
| InChI | InChI=1S/C23H25Cl2N7O3S/c1-31(2)23(33)35-17-12-4-3-11(9-12)14(17)27-15-13(24)10-26-20-16(15)28-21(30-20)18-19(25)29-22(36-18)32-5-7-34-8-6-32/h3-4,10-12,14,17H,5-9H2,1-2H3,(H2,26,27,28,30)/t11-,12+,14+,17-/m0/s1 |
| InChIKey | JYWJKGQRJJPRJG-RKCSVJPLSA-N |
| XLogP | 4.28 |
| TPSA | 108.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.47 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|