C29H36ClN7O3 — CID 118643590
[(1S,2S,3R,4R)-3-[[6-chloro-2-[4-[2-(4-methylpiperazin-1-yl)ethoxy]phenyl]-1H-imidazo[4,5-b]pyridin-7-yl]amino]-2-bicyclo[2.2.1]hept-5-enyl] N,N-dimethylcarbamate (PubChem CID 118643590) has the molecular formula C29H36ClN7O3 and a molecular weight of 566.11 g/mol. Its IUPAC name is [(1S,2S,3R,4R)-3-[[6-chloro-2-[4-[2-(4-methylpiperazin-1-yl)ethoxy]phenyl]-1H-imidazo[4,5-b]pyridin-7-yl]amino]-2-bicyclo[2.2.1]hept-5-enyl] N,N-dimethylcarbamate.
| Compound Name | [(1S,2S,3R,4R)-3-[[6-chloro-2-[4-[2-(4-methylpiperazin-1-yl)ethoxy]phenyl]-1H-imidazo[4,5-b]pyridin-7-yl]amino]-2-bicyclo[2.2.1]hept-5-enyl] N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 118643590 |
| Molecular Formula | C29H36ClN7O3 |
| Molecular Weight | 566.11 g/mol |
| Exact Mass | 565.26 |
| IUPAC Name | [(1S,2S,3R,4R)-3-[[6-chloro-2-[4-[2-(4-methylpiperazin-1-yl)ethoxy]phenyl]-1H-imidazo[4,5-b]pyridin-7-yl]amino]-2-bicyclo[2.2.1]hept-5-enyl] N,N-dimethylcarbamate |
| SMILES | CN1CCN(CCOc2ccc(-c3nc4ncc(Cl)c(N[C@H]5[C@@H](OC(=O)N(C)C)[C@@H]6C=C[C@H]5C6)c4[nH]3)cc2)CC1 |
| InChI | InChI=1S/C29H36ClN7O3/c1-35(2)29(38)40-26-20-5-4-19(16-20)23(26)32-24-22(30)17-31-28-25(24)33-27(34-28)18-6-8-21(9-7-18)39-15-14-37-12-10-36(3)11-13-37/h4-9,17,19-20,23,26H,10-16H2,1-3H3,(H2,31,32,33,34)/t19-,20+,23+,26-/m0/s1 |
| InChIKey | GOIDGULHPWYQPZ-ABALZIDYSA-N |
| XLogP | 3.96 |
| TPSA | 98.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.11 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|