C22H27ClN6O2 — CID 122446504
N-[2-[4-[6-chloro-7-[(1-methylpiperidin-4-yl)amino]-1H-imidazo[4,5-b]pyridin-2-yl]phenoxy]ethyl]acetamide (PubChem CID 122446504) has the molecular formula C22H27ClN6O2 and a molecular weight of 442.95 g/mol. Its IUPAC name is N-[2-[4-[6-chloro-7-[(1-methylpiperidin-4-yl)amino]-1H-imidazo[4,5-b]pyridin-2-yl]phenoxy]ethyl]acetamide.
| Compound Name | N-[2-[4-[6-chloro-7-[(1-methylpiperidin-4-yl)amino]-1H-imidazo[4,5-b]pyridin-2-yl]phenoxy]ethyl]acetamide |
|---|---|
| PubChem CID | 122446504 |
| Molecular Formula | C22H27ClN6O2 |
| Molecular Weight | 442.95 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | N-[2-[4-[6-chloro-7-[(1-methylpiperidin-4-yl)amino]-1H-imidazo[4,5-b]pyridin-2-yl]phenoxy]ethyl]acetamide |
| SMILES | CC(=O)NCCOc1ccc(-c2nc3ncc(Cl)c(NC4CCN(C)CC4)c3[nH]2)cc1 |
| InChI | InChI=1S/C22H27ClN6O2/c1-14(30)24-9-12-31-17-5-3-15(4-6-17)21-27-20-19(18(23)13-25-22(20)28-21)26-16-7-10-29(2)11-8-16/h3-6,13,16H,7-12H2,1-2H3,(H,24,30)(H2,25,26,27,28) |
| InChIKey | GNECURWMSKBIMQ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 95.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.95 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|