C20H22ClN5O2 — CID 175138627
[4-[6-chloro-7-[(1-methylpiperidin-4-yl)amino]-1H-imidazo[4,5-b]pyridin-2-yl]phenyl] acetate (PubChem CID 175138627) has the molecular formula C20H22ClN5O2 and a molecular weight of 399.88 g/mol. Its IUPAC name is [4-[6-chloro-7-[(1-methylpiperidin-4-yl)amino]-1H-imidazo[4,5-b]pyridin-2-yl]phenyl] acetate.
| Compound Name | [4-[6-chloro-7-[(1-methylpiperidin-4-yl)amino]-1H-imidazo[4,5-b]pyridin-2-yl]phenyl] acetate |
|---|---|
| PubChem CID | 175138627 |
| Molecular Formula | C20H22ClN5O2 |
| Molecular Weight | 399.88 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | [4-[6-chloro-7-[(1-methylpiperidin-4-yl)amino]-1H-imidazo[4,5-b]pyridin-2-yl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(-c2nc3ncc(Cl)c(NC4CCN(C)CC4)c3[nH]2)cc1 |
| InChI | InChI=1S/C20H22ClN5O2/c1-12(27)28-15-5-3-13(4-6-15)19-24-18-17(16(21)11-22-20(18)25-19)23-14-7-9-26(2)10-8-14/h3-6,11,14H,7-10H2,1-2H3,(H2,22,23,24,25) |
| InChIKey | AYPYHJBEUUMWMV-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.88 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|