C26H30BrN7O3 — CID 118643654
[(1S,2S,3R,4R)-3-[[6-bromo-2-[2-methoxy-4-(4-methylpiperazin-1-yl)phenyl]-1H-imidazo[4,5-b]pyridin-7-yl]amino]-2-bicyclo[2.2.1]hept-5-enyl] carbamate (PubChem CID 118643654) has the molecular formula C26H30BrN7O3 and a molecular weight of 568.48 g/mol. Its IUPAC name is [(1S,2S,3R,4R)-3-[[6-bromo-2-[2-methoxy-4-(4-methylpiperazin-1-yl)phenyl]-1H-imidazo[4,5-b]pyridin-7-yl]amino]-2-bicyclo[2.2.1]hept-5-enyl] carbamate.
| Compound Name | [(1S,2S,3R,4R)-3-[[6-bromo-2-[2-methoxy-4-(4-methylpiperazin-1-yl)phenyl]-1H-imidazo[4,5-b]pyridin-7-yl]amino]-2-bicyclo[2.2.1]hept-5-enyl] carbamate |
|---|---|
| PubChem CID | 118643654 |
| Molecular Formula | C26H30BrN7O3 |
| Molecular Weight | 568.48 g/mol |
| Exact Mass | 567.16 |
| IUPAC Name | [(1S,2S,3R,4R)-3-[[6-bromo-2-[2-methoxy-4-(4-methylpiperazin-1-yl)phenyl]-1H-imidazo[4,5-b]pyridin-7-yl]amino]-2-bicyclo[2.2.1]hept-5-enyl] carbamate |
| SMILES | COc1cc(N2CCN(C)CC2)ccc1-c1nc2ncc(Br)c(N[C@H]3[C@@H](OC(N)=O)[C@@H]4C=C[C@H]3C4)c2[nH]1 |
| InChI | InChI=1S/C26H30BrN7O3/c1-33-7-9-34(10-8-33)16-5-6-17(19(12-16)36-2)24-31-22-21(18(27)13-29-25(22)32-24)30-20-14-3-4-15(11-14)23(20)37-26(28)35/h3-6,12-15,20,23H,7-11H2,1-2H3,(H2,28,35)(H2,29,30,31,32)/t14-,15+,20+,23-/m0/s1 |
| InChIKey | MPWHZRSBUGWYBI-GEQJBKCRSA-N |
| XLogP | 3.60 |
| TPSA | 121.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.48 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|