C26H29ClN6O3 — CID 71679338
(1S,2S,3R,4S)-3-[[6-chloro-2-[4-[[(3R)-3-hydroxypyrrolidin-1-yl]methyl]-2-methoxyphenyl]-1H-imidazo[4,5-b]pyridin-7-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide (PubChem CID 71679338) has the molecular formula C26H29ClN6O3 and a molecular weight of 509.01 g/mol. Its IUPAC name is (1S,2S,3R,4S)-3-[[6-chloro-2-[4-[[(3R)-3-hydroxypyrrolidin-1-yl]methyl]-2-methoxyphenyl]-1H-imidazo[4,5-b]pyridin-7-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide.
| Compound Name | (1S,2S,3R,4S)-3-[[6-chloro-2-[4-[[(3R)-3-hydroxypyrrolidin-1-yl]methyl]-2-methoxyphenyl]-1H-imidazo[4,5-b]pyridin-7-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
|---|---|
| PubChem CID | 71679338 |
| Molecular Formula | C26H29ClN6O3 |
| Molecular Weight | 509.01 g/mol |
| Exact Mass | 508.20 |
| IUPAC Name | (1S,2S,3R,4S)-3-[[6-chloro-2-[4-[[(3R)-3-hydroxypyrrolidin-1-yl]methyl]-2-methoxyphenyl]-1H-imidazo[4,5-b]pyridin-7-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
| SMILES | COc1cc(CN2CC[C@@H](O)C2)ccc1-c1nc2ncc(Cl)c(N[C@H]3[C@@H](C(N)=O)[C@@H]4C=C[C@@H]3C4)c2[nH]1 |
| InChI | InChI=1S/C26H29ClN6O3/c1-36-19-8-13(11-33-7-6-16(34)12-33)2-5-17(19)25-31-23-22(18(27)10-29-26(23)32-25)30-21-15-4-3-14(9-15)20(21)24(28)35/h2-5,8,10,14-16,20-21,34H,6-7,9,11-12H2,1H3,(H2,28,35)(H2,29,30,31,32)/t14-,15-,16-,20+,21-/m1/s1 |
| InChIKey | VKTLNWJFZQZSRY-IULBNUBQSA-N |
| XLogP | 2.94 |
| TPSA | 129.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.01 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|