C24H31ClN6O4 — CID 118643599
tert-butyl [3-[7-[[(1R,2R,3S,4S)-3-carbamoyl-2-bicyclo[2.2.1]hept-5-enyl]amino]-6-chloro-1H-imidazo[4,5-b]pyridin-2-yl]piperidin-1-yl] carbonate (PubChem CID 118643599) has the molecular formula C24H31ClN6O4 and a molecular weight of 503.00 g/mol. Its IUPAC name is tert-butyl [3-[7-[[(1R,2R,3S,4S)-3-carbamoyl-2-bicyclo[2.2.1]hept-5-enyl]amino]-6-chloro-1H-imidazo[4,5-b]pyridin-2-yl]piperidin-1-yl] carbonate.
| Compound Name | tert-butyl [3-[7-[[(1R,2R,3S,4S)-3-carbamoyl-2-bicyclo[2.2.1]hept-5-enyl]amino]-6-chloro-1H-imidazo[4,5-b]pyridin-2-yl]piperidin-1-yl] carbonate |
|---|---|
| PubChem CID | 118643599 |
| Molecular Formula | C24H31ClN6O4 |
| Molecular Weight | 503.00 g/mol |
| Exact Mass | 502.21 |
| IUPAC Name | tert-butyl [3-[7-[[(1R,2R,3S,4S)-3-carbamoyl-2-bicyclo[2.2.1]hept-5-enyl]amino]-6-chloro-1H-imidazo[4,5-b]pyridin-2-yl]piperidin-1-yl] carbonate |
| SMILES | CC(C)(C)OC(=O)ON1CCCC(c2nc3ncc(Cl)c(N[C@H]4[C@@H](C(N)=O)[C@@H]5C=C[C@H]4C5)c3[nH]2)C1 |
| InChI | InChI=1S/C24H31ClN6O4/c1-24(2,3)34-23(33)35-31-8-4-5-14(11-31)21-29-19-18(15(25)10-27-22(19)30-21)28-17-13-7-6-12(9-13)16(17)20(26)32/h6-7,10,12-14,16-17H,4-5,8-9,11H2,1-3H3,(H2,26,32)(H2,27,28,29,30)/t12-,13+,14?,16+,17-/m1/s1 |
| InChIKey | JOGXEBSRZRKVOE-NNEPTKMSSA-N |
| XLogP | 3.75 |
| TPSA | 135.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.00 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|