C20H27ClN6O — CID 123983333
6-[(6-chloro-2-piperidin-3-yl-1H-imidazo[4,5-b]pyridin-7-yl)amino]-5-ethylcyclohex-3-ene-1-carboxamide (PubChem CID 123983333) has the molecular formula C20H27ClN6O and a molecular weight of 402.93 g/mol. Its IUPAC name is 6-[(6-chloro-2-piperidin-3-yl-1H-imidazo[4,5-b]pyridin-7-yl)amino]-5-ethylcyclohex-3-ene-1-carboxamide.
| Compound Name | 6-[(6-chloro-2-piperidin-3-yl-1H-imidazo[4,5-b]pyridin-7-yl)amino]-5-ethylcyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 123983333 |
| Molecular Formula | C20H27ClN6O |
| Molecular Weight | 402.93 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | 6-[(6-chloro-2-piperidin-3-yl-1H-imidazo[4,5-b]pyridin-7-yl)amino]-5-ethylcyclohex-3-ene-1-carboxamide |
| SMILES | CCC1C=CCC(C(N)=O)C1Nc1c(Cl)cnc2nc(C3CCCNC3)[nH]c12 |
| InChI | InChI=1S/C20H27ClN6O/c1-2-11-5-3-7-13(18(22)28)15(11)25-16-14(21)10-24-20-17(16)26-19(27-20)12-6-4-8-23-9-12/h3,5,10-13,15,23H,2,4,6-9H2,1H3,(H2,22,28)(H2,24,25,26,27) |
| InChIKey | HJHBFQFJYYFPEA-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 108.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.93 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|