C14H17BrClN3O — CID 118647402
6-bromo-5-chloro-8-[[(3R)-1-methylpiperidin-3-yl]methoxy]imidazo[1,5-a]pyridine (PubChem CID 118647402) has the molecular formula C14H17BrClN3O and a molecular weight of 358.67 g/mol. Its IUPAC name is 6-bromo-5-chloro-8-[[(3R)-1-methylpiperidin-3-yl]methoxy]imidazo[1,5-a]pyridine.
| Compound Name | 6-bromo-5-chloro-8-[[(3R)-1-methylpiperidin-3-yl]methoxy]imidazo[1,5-a]pyridine |
|---|---|
| PubChem CID | 118647402 |
| Molecular Formula | C14H17BrClN3O |
| Molecular Weight | 358.67 g/mol |
| Exact Mass | 357.02 |
| IUPAC Name | 6-bromo-5-chloro-8-[[(3R)-1-methylpiperidin-3-yl]methoxy]imidazo[1,5-a]pyridine |
| SMILES | CN1CCC[C@@H](COc2cc(Br)c(Cl)n3cncc23)C1 |
| InChI | InChI=1S/C14H17BrClN3O/c1-18-4-2-3-10(7-18)8-20-13-5-11(15)14(16)19-9-17-6-12(13)19/h5-6,9-10H,2-4,7-8H2,1H3/t10-/m1/s1 |
| InChIKey | SACCVPZEDFBHOM-SNVBAGLBSA-N |
| XLogP | 3.47 |
| TPSA | 29.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.67 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|