C23H27ClN4O — CID 137470117
(2E,4E)-5-[5-chloro-8-[[(3R)-1-ethylpiperidin-3-yl]methoxy]imidazo[1,5-a]pyridin-6-yl]-2-ethenylhexa-2,4-dienenitrile (PubChem CID 137470117) has the molecular formula C23H27ClN4O and a molecular weight of 410.95 g/mol. Its IUPAC name is (2E,4E)-5-[5-chloro-8-[[(3R)-1-ethylpiperidin-3-yl]methoxy]imidazo[1,5-a]pyridin-6-yl]-2-ethenylhexa-2,4-dienenitrile.
| Compound Name | (2E,4E)-5-[5-chloro-8-[[(3R)-1-ethylpiperidin-3-yl]methoxy]imidazo[1,5-a]pyridin-6-yl]-2-ethenylhexa-2,4-dienenitrile |
|---|---|
| PubChem CID | 137470117 |
| Molecular Formula | C23H27ClN4O |
| Molecular Weight | 410.95 g/mol |
| Exact Mass | 410.19 |
| IUPAC Name | (2E,4E)-5-[5-chloro-8-[[(3R)-1-ethylpiperidin-3-yl]methoxy]imidazo[1,5-a]pyridin-6-yl]-2-ethenylhexa-2,4-dienenitrile |
| SMILES | C=C/C(C#N)=C\C=C(/C)c1cc(OC[C@@H]2CCCN(CC)C2)c2cncn2c1Cl |
| InChI | InChI=1S/C23H27ClN4O/c1-4-18(12-25)9-8-17(3)20-11-22(21-13-26-16-28(21)23(20)24)29-15-19-7-6-10-27(5-2)14-19/h4,8-9,11,13,16,19H,1,5-7,10,14-15H2,2-3H3/b17-8+,18-9+/t19-/m1/s1 |
| InChIKey | RWASFSPORUADEG-BYGQCYTQSA-N |
| XLogP | 5.14 |
| TPSA | 53.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.95 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|