C22H25ClN4O — CID 144996855
4-(5-chloro-8-methoxyimidazo[1,5-a]pyridin-6-yl)benzonitrile;1-ethylpiperidine (PubChem CID 144996855) has the molecular formula C22H25ClN4O and a molecular weight of 396.92 g/mol. Its IUPAC name is 4-(5-chloro-8-methoxyimidazo[1,5-a]pyridin-6-yl)benzonitrile;1-ethylpiperidine.
| Compound Name | 4-(5-chloro-8-methoxyimidazo[1,5-a]pyridin-6-yl)benzonitrile;1-ethylpiperidine |
|---|---|
| PubChem CID | 144996855 |
| Molecular Formula | C22H25ClN4O |
| Molecular Weight | 396.92 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | 4-(5-chloro-8-methoxyimidazo[1,5-a]pyridin-6-yl)benzonitrile;1-ethylpiperidine |
| SMILES | CCN1CCCCC1.COc1cc(-c2ccc(C#N)cc2)c(Cl)n2cncc12 |
| InChI | InChI=1S/C15H10ClN3O.C7H15N/c1-20-14-6-12(11-4-2-10(7-17)3-5-11)15(16)19-9-18-8-13(14)19;1-2-8-6-4-3-5-7-8/h2-6,8-9H,1H3;2-7H2,1H3 |
| InChIKey | BRKXBWBHFMLAPY-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 53.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.92 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|