About 2-[2-(2-hydroxyethoxy)ethoxy]ethanol;2-propan-2-yloxypyridine
2-[2-(2-hydroxyethoxy)ethoxy]ethanol;2-propan-2-yloxypyridine (PubChem CID 118647854) has the molecular formula C14H25NO5
and a molecular weight of 287.36 g/mol. Its IUPAC name is 2-[2-(2-hydroxyethoxy)ethoxy]ethanol;2-propan-2-yloxypyridine.
Molecular Properties
| Compound Name | 2-[2-(2-hydroxyethoxy)ethoxy]ethanol;2-propan-2-yloxypyridine |
| PubChem CID | 118647854 |
| Molecular Formula | C14H25NO5 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | 2-[2-(2-hydroxyethoxy)ethoxy]ethanol;2-propan-2-yloxypyridine |
| SMILES | CC(C)Oc1ccccn1.OCCOCCOCCO |
| InChI | InChI=1S/C8H11NO.C6H14O4/c1-7(2)10-8-5-3-4-6-9-8;7-1-3-9-5-6-10-4-2-8/h3-7H,1-2H3;7-8H,1-6H2 |
| InChIKey | MWLWNHMUIYRFIY-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 81.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(2-hydroxyethoxy)ethoxy]ethanol;2-propan-2-yloxypyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(2-hydroxyethoxy)ethoxy]ethanol;2-propan-2-yloxypyridine?
The IUPAC name of 2-[2-(2-hydroxyethoxy)ethoxy]ethanol;2-propan-2-yloxypyridine (CID 118647854) is 2-[2-(2-hydroxyethoxy)ethoxy]ethanol;2-propan-2-yloxypyridine.
What is the SMILES notation for 2-[2-(2-hydroxyethoxy)ethoxy]ethanol;2-propan-2-yloxypyridine?
The canonical SMILES for 2-[2-(2-hydroxyethoxy)ethoxy]ethanol;2-propan-2-yloxypyridine is CC(C)Oc1ccccn1.OCCOCCOCCO.
What is the InChIKey of 2-[2-(2-hydroxyethoxy)ethoxy]ethanol;2-propan-2-yloxypyridine?
The InChIKey is MWLWNHMUIYRFIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO.C6H14O4/c1-7(2)10-8-5-3-4-6-9-8;7-1-3-9-5-6-10-4-2-8/h3-7H,1-2H3;7-8H,1-6H2.
What are the key properties of 2-[2-(2-hydroxyethoxy)ethoxy]ethanol;2-propan-2-yloxypyridine?
2-[2-(2-hydroxyethoxy)ethoxy]ethanol;2-propan-2-yloxypyridine has a molecular weight of 287.36 g/mol, XLogP of 0.87, 9 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2-hydroxyethoxy)ethoxy]ethanol;2-propan-2-yloxypyridine is sourced from PubChem (CID 118647854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).