About 2-pentan-3-yloxypyridine
2-pentan-3-yloxypyridine (PubChem CID 45091035) has the molecular formula C10H15NO
and a molecular weight of 165.24 g/mol. Its IUPAC name is 2-pentan-3-yloxypyridine.
Molecular Properties
| Compound Name | 2-pentan-3-yloxypyridine |
| PubChem CID | 45091035 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | 2-pentan-3-yloxypyridine |
| SMILES | CCC(CC)Oc1ccccn1 |
| InChI | InChI=1S/C10H15NO/c1-3-9(4-2)12-10-7-5-6-8-11-10/h5-9H,3-4H2,1-2H3 |
| InChIKey | DZNJJGQVWVHLCZ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-pentan-3-yloxypyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pentan-3-yloxypyridine?
The IUPAC name of 2-pentan-3-yloxypyridine (CID 45091035) is 2-pentan-3-yloxypyridine.
What is the SMILES notation for 2-pentan-3-yloxypyridine?
The canonical SMILES for 2-pentan-3-yloxypyridine is CCC(CC)Oc1ccccn1.
What is the InChIKey of 2-pentan-3-yloxypyridine?
The InChIKey is DZNJJGQVWVHLCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO/c1-3-9(4-2)12-10-7-5-6-8-11-10/h5-9H,3-4H2,1-2H3.
What are the key properties of 2-pentan-3-yloxypyridine?
2-pentan-3-yloxypyridine has a molecular weight of 165.24 g/mol, XLogP of 2.65, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pentan-3-yloxypyridine is sourced from PubChem (CID 45091035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).