C31H34N6O3 — CID 118651819
4-amino-3-(4-phenoxyphenyl)-1-[(3R)-1-[(E)-4-pyrrolidin-1-ylbut-2-enoyl]piperidin-3-yl]-6H-pyrrolo[2,3-d]pyridazin-7-one (PubChem CID 118651819) has the molecular formula C31H34N6O3 and a molecular weight of 538.65 g/mol. Its IUPAC name is 4-amino-3-(4-phenoxyphenyl)-1-[(3R)-1-[(E)-4-pyrrolidin-1-ylbut-2-enoyl]piperidin-3-yl]-6H-pyrrolo[2,3-d]pyridazin-7-one.
| Compound Name | 4-amino-3-(4-phenoxyphenyl)-1-[(3R)-1-[(E)-4-pyrrolidin-1-ylbut-2-enoyl]piperidin-3-yl]-6H-pyrrolo[2,3-d]pyridazin-7-one |
|---|---|
| PubChem CID | 118651819 |
| Molecular Formula | C31H34N6O3 |
| Molecular Weight | 538.65 g/mol |
| Exact Mass | 538.27 |
| IUPAC Name | 4-amino-3-(4-phenoxyphenyl)-1-[(3R)-1-[(E)-4-pyrrolidin-1-ylbut-2-enoyl]piperidin-3-yl]-6H-pyrrolo[2,3-d]pyridazin-7-one |
| SMILES | Nc1n[nH]c(=O)c2c1c(-c1ccc(Oc3ccccc3)cc1)cn2[C@@H]1CCCN(C(=O)/C=C/CN2CCCC2)C1 |
| InChI | InChI=1S/C31H34N6O3/c32-30-28-26(22-12-14-25(15-13-22)40-24-9-2-1-3-10-24)21-37(29(28)31(39)34-33-30)23-8-6-19-36(20-23)27(38)11-7-18-35-16-4-5-17-35/h1-3,7,9-15,21,23H,4-6,8,16-20H2,(H2,32,33)(H,34,39)/b11-7+/t23-/m1/s1 |
| InChIKey | DTDAAWRYDDIOBP-GULCCPCXSA-N |
| XLogP | 4.58 |
| TPSA | 109.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.65 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|