C27H25F2N5O3 — CID 118649384
4-amino-1-[1-[(E)-but-2-enoyl]piperidin-3-yl]-3-[4-(2,6-difluorophenoxy)phenyl]-6H-pyrrolo[2,3-d]pyridazin-7-one (PubChem CID 118649384) has the molecular formula C27H25F2N5O3 and a molecular weight of 505.53 g/mol. Its IUPAC name is 4-amino-1-[1-[(E)-but-2-enoyl]piperidin-3-yl]-3-[4-(2,6-difluorophenoxy)phenyl]-6H-pyrrolo[2,3-d]pyridazin-7-one.
| Compound Name | 4-amino-1-[1-[(E)-but-2-enoyl]piperidin-3-yl]-3-[4-(2,6-difluorophenoxy)phenyl]-6H-pyrrolo[2,3-d]pyridazin-7-one |
|---|---|
| PubChem CID | 118649384 |
| Molecular Formula | C27H25F2N5O3 |
| Molecular Weight | 505.53 g/mol |
| Exact Mass | 505.19 |
| IUPAC Name | 4-amino-1-[1-[(E)-but-2-enoyl]piperidin-3-yl]-3-[4-(2,6-difluorophenoxy)phenyl]-6H-pyrrolo[2,3-d]pyridazin-7-one |
| SMILES | C/C=C/C(=O)N1CCCC(n2cc(-c3ccc(Oc4c(F)cccc4F)cc3)c3c(N)n[nH]c(=O)c32)C1 |
| InChI | InChI=1S/C27H25F2N5O3/c1-2-5-22(35)33-13-4-6-17(14-33)34-15-19(23-24(34)27(36)32-31-26(23)30)16-9-11-18(12-10-16)37-25-20(28)7-3-8-21(25)29/h2-3,5,7-12,15,17H,4,6,13-14H2,1H3,(H2,30,31)(H,32,36)/b5-2+ |
| InChIKey | PSSRRXQOBFHSME-GORDUTHDSA-N |
| XLogP | 4.78 |
| TPSA | 106.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.53 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|