C26H23F2N5O2 — CID 150272187
1-[(3R)-3-[4-amino-3-[4-(2,6-difluorophenoxy)phenyl]pyrrolo[2,3-d]pyridazin-1-yl]piperidin-1-yl]prop-2-en-1-one (PubChem CID 150272187) has the molecular formula C26H23F2N5O2 and a molecular weight of 475.50 g/mol. Its IUPAC name is 1-[(3R)-3-[4-amino-3-[4-(2,6-difluorophenoxy)phenyl]pyrrolo[2,3-d]pyridazin-1-yl]piperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[(3R)-3-[4-amino-3-[4-(2,6-difluorophenoxy)phenyl]pyrrolo[2,3-d]pyridazin-1-yl]piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 150272187 |
| Molecular Formula | C26H23F2N5O2 |
| Molecular Weight | 475.50 g/mol |
| Exact Mass | 475.18 |
| IUPAC Name | 1-[(3R)-3-[4-amino-3-[4-(2,6-difluorophenoxy)phenyl]pyrrolo[2,3-d]pyridazin-1-yl]piperidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCC[C@@H](n2cc(-c3ccc(Oc4c(F)cccc4F)cc3)c3c(N)nncc32)C1 |
| InChI | InChI=1S/C26H23F2N5O2/c1-2-23(34)32-12-4-5-17(14-32)33-15-19(24-22(33)13-30-31-26(24)29)16-8-10-18(11-9-16)35-25-20(27)6-3-7-21(25)28/h2-3,6-11,13,15,17H,1,4-5,12,14H2,(H2,29,31)/t17-/m1/s1 |
| InChIKey | GDUKPXDVGUVTRM-QGZVFWFLSA-N |
| XLogP | 5.10 |
| TPSA | 86.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.50 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|