C22H29ClN4O3 — CID 118652671
tert-butyl (3R)-3-[[5-chloro-2-hydrazinyl-6-(4-methylphenyl)-3-pyridinyl]oxymethyl]pyrrolidine-1-carboxylate (PubChem CID 118652671) has the molecular formula C22H29ClN4O3 and a molecular weight of 432.95 g/mol. Its IUPAC name is tert-butyl (3R)-3-[[5-chloro-2-hydrazinyl-6-(4-methylphenyl)-3-pyridinyl]oxymethyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[[5-chloro-2-hydrazinyl-6-(4-methylphenyl)-3-pyridinyl]oxymethyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 118652671 |
| Molecular Formula | C22H29ClN4O3 |
| Molecular Weight | 432.95 g/mol |
| Exact Mass | 432.19 |
| IUPAC Name | tert-butyl (3R)-3-[[5-chloro-2-hydrazinyl-6-(4-methylphenyl)-3-pyridinyl]oxymethyl]pyrrolidine-1-carboxylate |
| SMILES | Cc1ccc(-c2nc(NN)c(OC[C@@H]3CCN(C(=O)OC(C)(C)C)C3)cc2Cl)cc1 |
| InChI | InChI=1S/C22H29ClN4O3/c1-14-5-7-16(8-6-14)19-17(23)11-18(20(25-19)26-24)29-13-15-9-10-27(12-15)21(28)30-22(2,3)4/h5-8,11,15H,9-10,12-13,24H2,1-4H3,(H,25,26)/t15-/m1/s1 |
| InChIKey | IIXSAMNZSNYCHL-OAHLLOKOSA-N |
| XLogP | 4.63 |
| TPSA | 89.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.95 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|