C9H11N3O2S — CID 118652702
6-acetyl-3-methylsulfanyl-2-prop-2-enyl-1,2,4-triazin-5-one (PubChem CID 118652702) has the molecular formula C9H11N3O2S and a molecular weight of 225.27 g/mol. Its IUPAC name is 6-acetyl-3-methylsulfanyl-2-prop-2-enyl-1,2,4-triazin-5-one.
| Compound Name | 6-acetyl-3-methylsulfanyl-2-prop-2-enyl-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 118652702 |
| Molecular Formula | C9H11N3O2S |
| Molecular Weight | 225.27 g/mol |
| Exact Mass | 225.06 |
| IUPAC Name | 6-acetyl-3-methylsulfanyl-2-prop-2-enyl-1,2,4-triazin-5-one |
| SMILES | C=CCn1nc(C(C)=O)c(=O)nc1SC |
| InChI | InChI=1S/C9H11N3O2S/c1-4-5-12-9(15-3)10-8(14)7(11-12)6(2)13/h4H,1,5H2,2-3H3 |
| InChIKey | OHJITMQDEMAVIH-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.27 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|